![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 4 pillar trainingmp4.mp4 | 2025-03-25 07:45 | 422M | |
| Common Law Courts Protocol - Overview.pdf | 2025-03-25 07:46 | 3.8M | |
| Self Governance Flow chart.pdf | 2025-03-25 07:46 | 3.6M | |
| Credential Card w field Layout.docx | 2025-03-25 07:45 | 1.7M | |
| Ex-Parte-Milligan-August-30-2024-compressed-2.pdf | 2025-11-09 22:39 | 1.5M | |
| 4 pillars n Committees-Ohio.pdf | 2025-03-25 07:46 | 1.3M | |
| Common Law Courts Protocol - Interface With de facto Incidents -2.pdf | 2025-03-25 07:46 | 868K | |
| Assemby Guidelines Structure and Meetings (10-25-23).pdf | 2025-03-25 07:45 | 600K | |
| Officials Officers and Elections Original.pdf | 2025-03-25 07:46 | 590K | |
| Coroners Handbook Rev. 0 (10-1-23).pdf | 2025-03-25 07:46 | 502K | |
| Four Standing Pillars .pdf | 2025-03-25 07:46 | 490K | |
| Jural Assembly Handbook (WORKING).pdf | 2025-03-25 07:46 | 341K | |