![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| GMT20250530-001631_Recording_1920x912.mp4 | 2025-05-30 07:31 | 2.3G | |
| 2025-08-21-AnnaOnVettingAndUnionState.mp4 | 2025-10-24 08:45 | 98M | |
| Screenshot_20251017_195424_Photo Editor.jpg | 2025-12-01 12:21 | 645K | |
| ModelCounties-WebsiteDesign.pdf | 2025-12-01 15:08 | 450K | |
| Screenshot_20250924_095537_Messages.jpg | 2025-09-24 09:57 | 334K | |
| Article-931.-Structure-of-the-Original-Government-Being-Restored-Using-the-Example-of-The-Republic-of-Texas.pdf | 2025-11-18 10:29 | 161K | |
| RE_ Nevada support via Lisa Schaffer.pdf | 2025-12-01 09:05 | 141K | |
| Re_ Need proof of allegations against Sue and Doug Hulsebus1.pdf | 2025-12-01 09:08 | 139K | |
| messagetothemilitary2.pdf | 2025-10-22 10:24 | 132K | |
| Nevada support via Lisa Schaffer.pdf | 2025-12-01 09:04 | 130K | |
| Re_ Need proof of allegations against Sue and Doug Hulsebus.pdf | 2025-12-01 09:06 | 122K | |
| Re_ You talked about vetting.pdf | 2025-10-24 08:53 | 117K | |
| Re_ Sue.pdf | 2025-12-01 08:42 | 112K | |
| Re_ Clarification Please.pdf | 2025-12-01 09:19 | 111K | |